C15H22F3N3O3S — CID 155302696
(2R,3R,4R,5S)-2-methyl-1-[[(3R)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 155302696) has the molecular formula C15H22F3N3O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[(3R)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[(3R)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155302696 |
| Molecular Formula | C15H22F3N3O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[(3R)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@H]1CCN(c2nc(C(F)(F)F)cs2)C1 |
| InChI | InChI=1S/C15H22F3N3O3S/c1-8-12(23)13(24)10(22)6-21(8)5-9-2-3-20(4-9)14-19-11(7-25-14)15(16,17)18/h7-10,12-13,22-24H,2-6H2,1H3/t8-,9+,10+,12-,13-/m1/s1 |
| InChIKey | YCOZIICNBDBAOP-STPAWDDFSA-N |
| XLogP | 0.77 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |