C17H15F3O2 — CID 15530341
phenyl-[2-(trifluoromethyl)-4a,5,6,8a-tetrahydro-4H-chromen-3-yl]methanone (PubChem CID 15530341) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is phenyl-[2-(trifluoromethyl)-4a,5,6,8a-tetrahydro-4H-chromen-3-yl]methanone.
| Compound Name | phenyl-[2-(trifluoromethyl)-4a,5,6,8a-tetrahydro-4H-chromen-3-yl]methanone |
|---|---|
| PubChem CID | 15530341 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | phenyl-[2-(trifluoromethyl)-4a,5,6,8a-tetrahydro-4H-chromen-3-yl]methanone |
| SMILES | O=C(C1=C(C(F)(F)F)OC2C=CCCC2C1)c1ccccc1 |
| InChI | InChI=1S/C17H15F3O2/c18-17(19,20)16-13(15(21)11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)22-16/h1-3,5-7,9,12,14H,4,8,10H2 |
| InChIKey | GBUZDOPULDACFG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|