C21H36OS — CID 15530590
[(4Z,6Z)-6-methylsulfanyltetradeca-1,4,6-trien-5-yl]oxycyclohexane (PubChem CID 15530590) has the molecular formula C21H36OS and a molecular weight of 336.59 g/mol. Its IUPAC name is [(4Z,6Z)-6-methylsulfanyltetradeca-1,4,6-trien-5-yl]oxycyclohexane.
| Compound Name | [(4Z,6Z)-6-methylsulfanyltetradeca-1,4,6-trien-5-yl]oxycyclohexane |
|---|---|
| PubChem CID | 15530590 |
| Molecular Formula | C21H36OS |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | [(4Z,6Z)-6-methylsulfanyltetradeca-1,4,6-trien-5-yl]oxycyclohexane |
| SMILES | C=CC/C=C(OC1CCCCC1)/C(=C/CCCCCCC)SC |
| InChI | InChI=1S/C21H36OS/c1-4-6-8-9-10-14-18-21(23-3)20(17-7-5-2)22-19-15-12-11-13-16-19/h5,17-19H,2,4,6-16H2,1,3H3/b20-17-,21-18- |
| InChIKey | FDBDJMXAMGOAMG-HIOQQWDOSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|