C14H24N2 — CID 155306096
(1E,3Z,5Z)-4-propan-2-yl-1-pyrrolidin-1-ylhepta-1,3,5-trien-1-amine (PubChem CID 155306096) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (1E,3Z,5Z)-4-propan-2-yl-1-pyrrolidin-1-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-4-propan-2-yl-1-pyrrolidin-1-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 155306096 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (1E,3Z,5Z)-4-propan-2-yl-1-pyrrolidin-1-ylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(=C/C=C(\N)N1CCCC1)C(C)C |
| InChI | InChI=1S/C14H24N2/c1-4-7-13(12(2)3)8-9-14(15)16-10-5-6-11-16/h4,7-9,12H,5-6,10-11,15H2,1-3H3/b7-4-,13-8+,14-9+ |
| InChIKey | UBDVYCKDTHYURB-WKNHKYHLSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|