About (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine
(4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine (PubChem CID 155306647) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine.
Molecular Properties
| Compound Name | (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine |
| PubChem CID | 155306647 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine |
| SMILES | CCCN1C(C)N(NC)C[C@@H]1C |
| InChI | InChI=1S/C9H21N3/c1-5-6-11-8(2)7-12(10-4)9(11)3/h8-10H,5-7H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | UJNWQBSZPNCRHM-IENPIDJESA-N |
| XLogP | 0.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine?
The IUPAC name of (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine (CID 155306647) is (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine.
What is the SMILES notation for (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine?
The canonical SMILES for (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine is CCCN1C(C)N(NC)C[C@@H]1C.
What is the InChIKey of (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine?
The InChIKey is UJNWQBSZPNCRHM-IENPIDJESA-N. The full InChI is InChI=1S/C9H21N3/c1-5-6-11-8(2)7-12(10-4)9(11)3/h8-10H,5-7H2,1-4H3/t8-,9?/m0/s1.
What are the key properties of (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine?
(4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine has a molecular weight of 171.29 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N,2,4-trimethyl-3-propylimidazolidin-1-amine is sourced from PubChem (CID 155306647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).