About 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine
4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine (PubChem CID 155306680) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine.
Molecular Properties
| Compound Name | 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine |
| PubChem CID | 155306680 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine |
| SMILES | CCCC(C)C1CN(CC)CC(C)=N1 |
| InChI | InChI=1S/C12H24N2/c1-5-7-10(3)12-9-14(6-2)8-11(4)13-12/h10,12H,5-9H2,1-4H3 |
| InChIKey | OQAUAUWGDIKPSW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine?
The IUPAC name of 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine (CID 155306680) is 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine.
What is the SMILES notation for 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine?
The canonical SMILES for 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine is CCCC(C)C1CN(CC)CC(C)=N1.
What is the InChIKey of 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine?
The InChIKey is OQAUAUWGDIKPSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-5-7-10(3)12-9-14(6-2)8-11(4)13-12/h10,12H,5-9H2,1-4H3.
What are the key properties of 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine?
4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine has a molecular weight of 196.34 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-methyl-2-pentan-2-yl-3,5-dihydro-2H-pyrazine is sourced from PubChem (CID 155306680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).