C26H29N7O3 — CID 155307463
3-amino-2-[1-[(E)-pent-2-enoyl]piperidin-2-yl]-5-[4-(pyridin-2-ylcarbamoyl)phenyl]imidazole-4-carboxamide (PubChem CID 155307463) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-amino-2-[1-[(E)-pent-2-enoyl]piperidin-2-yl]-5-[4-(pyridin-2-ylcarbamoyl)phenyl]imidazole-4-carboxamide.
| Compound Name | 3-amino-2-[1-[(E)-pent-2-enoyl]piperidin-2-yl]-5-[4-(pyridin-2-ylcarbamoyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 155307463 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 3-amino-2-[1-[(E)-pent-2-enoyl]piperidin-2-yl]-5-[4-(pyridin-2-ylcarbamoyl)phenyl]imidazole-4-carboxamide |
| SMILES | CC/C=C/C(=O)N1CCCCC1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c(C(N)=O)n1N |
| InChI | InChI=1S/C26H29N7O3/c1-2-3-10-21(34)32-16-7-5-8-19(32)25-31-22(23(24(27)35)33(25)28)17-11-13-18(14-12-17)26(36)30-20-9-4-6-15-29-20/h3-4,6,9-15,19H,2,5,7-8,16,28H2,1H3,(H2,27,35)(H,29,30,36)/b10-3+ |
| InChIKey | LZRMTZAJSYPUDS-XCVCLJGOSA-N |
| XLogP | 3.03 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|