About 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one
2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one (PubChem CID 155307663) has the molecular formula C16H13BrFNO2S
and a molecular weight of 382.25 g/mol. Its IUPAC name is 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one.
Molecular Properties
| Compound Name | 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one |
| PubChem CID | 155307663 |
| Molecular Formula | C16H13BrFNO2S |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one |
| SMILES | Cc1c(Br)sc2c1C(=O)N(Cc1cccc(F)c1)C21COC1 |
| InChI | InChI=1S/C16H13BrFNO2S/c1-9-12-13(22-14(9)17)16(7-21-8-16)19(15(12)20)6-10-3-2-4-11(18)5-10/h2-5H,6-8H2,1H3 |
| InChIKey | QMHIXFWVVVGYTF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one?
The IUPAC name of 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one (CID 155307663) is 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one.
What is the SMILES notation for 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one?
The canonical SMILES for 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one is Cc1c(Br)sc2c1C(=O)N(Cc1cccc(F)c1)C21COC1.
What is the InChIKey of 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one?
The InChIKey is QMHIXFWVVVGYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrFNO2S/c1-9-12-13(22-14(9)17)16(7-21-8-16)19(15(12)20)6-10-3-2-4-11(18)5-10/h2-5H,6-8H2,1H3.
What are the key properties of 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one?
2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one has a molecular weight of 382.25 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-bromo-5'-[(3-fluorophenyl)methyl]-3'-methylspiro[oxetane-3,6'-thieno[2,3-c]pyrrole]-4'-one is sourced from PubChem (CID 155307663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).