C33H31ClF3NO6S — CID 155307764
4-[(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid (PubChem CID 155307764) has the molecular formula C33H31ClF3NO6S and a molecular weight of 662.13 g/mol. Its IUPAC name is 4-[(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155307764 |
| Molecular Formula | C33H31ClF3NO6S |
| Molecular Weight | 662.13 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | 4-[(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-fluorocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(F)(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(OCc5c(F)cccc5Cl)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C33H31ClF3NO6S/c34-27-2-1-3-28(36)25(27)19-44-23-7-10-26-21(18-23)4-11-29-33(26,45(42,43)24-8-5-22(35)6-9-24)16-17-38(29)31(41)32(37)14-12-20(13-15-32)30(39)40/h1-3,5-10,18,20,29H,4,11-17,19H2,(H,39,40)/t20?,29-,32?,33-/m1/s1 |
| InChIKey | YQFBSIHKLQOEHM-GBLUQUMKSA-N |
| XLogP | 6.40 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.13 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |