C32H31F4NO6S2 — CID 155307780
[(3aR,9bR)-9b-(benzenesulfonyl)-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 155307780) has the molecular formula C32H31F4NO6S2 and a molecular weight of 665.73 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(benzenesulfonyl)-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 155307780 |
| Molecular Formula | C32H31F4NO6S2 |
| Molecular Weight | 665.73 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccccc3)c3ccc(OCc4c(F)cccc4C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C32H31F4NO6S2/c33-28-8-4-7-27(32(34,35)36)25(28)20-43-23-10-11-26-22(19-23)9-12-29-31(26,45(41,42)24-5-2-1-3-6-24)15-16-37(29)30(38)21-13-17-44(39,40)18-14-21/h1-8,10-11,19,21,29H,9,12-18,20H2/t29-,31-/m1/s1 |
| InChIKey | ZZYAEFZVQKUTEO-BVRKHOPBSA-N |
| XLogP | 5.46 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |