C33H32F5N3O5S — CID 155307789
4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide (PubChem CID 155307789) has the molecular formula C33H32F5N3O5S and a molecular weight of 677.69 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide.
| Compound Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 155307789 |
| Molecular Formula | C33H32F5N3O5S |
| Molecular Weight | 677.69 g/mol |
| Exact Mass | 677.20 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(OCc5c(F)cccc5C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C33H32F5N3O5S/c34-22-5-8-24(9-6-22)47(44,45)32-14-17-41(30(42)20-12-15-40(16-13-20)31(39)43)29(32)11-4-21-18-23(7-10-26(21)32)46-19-25-27(33(36,37)38)2-1-3-28(25)35/h1-3,5-10,18,20,29H,4,11-17,19H2,(H2,39,43)/t29-,32-/m1/s1 |
| InChIKey | YQXYCAHXEHLPQF-QLWXXVCSSA-N |
| XLogP | 5.57 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |