C32H30F5NO6S2 — CID 155307810
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 155307810) has the molecular formula C32H30F5NO6S2 and a molecular weight of 683.72 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 155307810 |
| Molecular Formula | C32H30F5NO6S2 |
| Molecular Weight | 683.72 g/mol |
| Exact Mass | 683.14 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(OCc4c(F)cccc4C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C32H30F5NO6S2/c33-22-5-8-24(9-6-22)46(42,43)31-14-15-38(30(39)20-12-16-45(40,41)17-13-20)29(31)11-4-21-18-23(7-10-26(21)31)44-19-25-27(32(35,36)37)2-1-3-28(25)34/h1-3,5-10,18,20,29H,4,11-17,19H2/t29-,31-/m1/s1 |
| InChIKey | CXDLRWXWEHCYEG-BVRKHOPBSA-N |
| XLogP | 5.60 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |