C11H13F3O2 — CID 15530796
3,3,6-trimethyl-5-(trifluoromethyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one (PubChem CID 15530796) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 3,3,6-trimethyl-5-(trifluoromethyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | 3,3,6-trimethyl-5-(trifluoromethyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 15530796 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,3,6-trimethyl-5-(trifluoromethyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one |
| SMILES | CC1=CC2OC1(C(F)(F)F)CC(C)(C)C2=O |
| InChI | InChI=1S/C11H13F3O2/c1-6-4-7-8(15)9(2,3)5-10(6,16-7)11(12,13)14/h4,7H,5H2,1-3H3 |
| InChIKey | DYDCNAXQTWNBNS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|