About 2,8-dimethylthieno[3,2-b][1]benzothiole
2,8-dimethylthieno[3,2-b][1]benzothiole (PubChem CID 155307998) has the molecular formula C12H10S2
and a molecular weight of 218.35 g/mol. Its IUPAC name is 2,8-dimethylthieno[3,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 2,8-dimethylthieno[3,2-b][1]benzothiole |
| PubChem CID | 155307998 |
| Molecular Formula | C12H10S2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2,8-dimethylthieno[3,2-b][1]benzothiole |
| SMILES | Cc1cc2sc3cccc(C)c3c2s1 |
| InChI | InChI=1S/C12H10S2/c1-7-4-3-5-9-11(7)12-10(14-9)6-8(2)13-12/h3-6H,1-2H3 |
| InChIKey | HJIAXRFXEDQULB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-dimethylthieno[3,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethylthieno[3,2-b][1]benzothiole?
The IUPAC name of 2,8-dimethylthieno[3,2-b][1]benzothiole (CID 155307998) is 2,8-dimethylthieno[3,2-b][1]benzothiole.
What is the SMILES notation for 2,8-dimethylthieno[3,2-b][1]benzothiole?
The canonical SMILES for 2,8-dimethylthieno[3,2-b][1]benzothiole is Cc1cc2sc3cccc(C)c3c2s1.
What is the InChIKey of 2,8-dimethylthieno[3,2-b][1]benzothiole?
The InChIKey is HJIAXRFXEDQULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S2/c1-7-4-3-5-9-11(7)12-10(14-9)6-8(2)13-12/h3-6H,1-2H3.
What are the key properties of 2,8-dimethylthieno[3,2-b][1]benzothiole?
2,8-dimethylthieno[3,2-b][1]benzothiole has a molecular weight of 218.35 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethylthieno[3,2-b][1]benzothiole is sourced from PubChem (CID 155307998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).