About 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene
6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene (PubChem CID 155308174) has the molecular formula C14H18S2
and a molecular weight of 250.43 g/mol. Its IUPAC name is 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene |
| PubChem CID | 155308174 |
| Molecular Formula | C14H18S2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene |
| SMILES | Cc1sc2c(C)csc2c1C1CCCCC1 |
| InChI | InChI=1S/C14H18S2/c1-9-8-15-14-12(10(2)16-13(9)14)11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3 |
| InChIKey | LQPJPVQDEQBEHH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene?
The IUPAC name of 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene (CID 155308174) is 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene.
What is the SMILES notation for 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene?
The canonical SMILES for 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene is Cc1sc2c(C)csc2c1C1CCCCC1.
What is the InChIKey of 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene?
The InChIKey is LQPJPVQDEQBEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18S2/c1-9-8-15-14-12(10(2)16-13(9)14)11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3.
What are the key properties of 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene?
6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene has a molecular weight of 250.43 g/mol, XLogP of 5.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyl-3,5-dimethylthieno[3,2-b]thiophene is sourced from PubChem (CID 155308174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).