About (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine
(Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine (PubChem CID 155308601) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine.
Molecular Properties
| Compound Name | (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine |
| PubChem CID | 155308601 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine |
| SMILES | CC/C=C\C[C@@H](NC)C(C)(CC)/N=C/CC |
| InChI | InChI=1S/C14H28N2/c1-6-9-10-11-13(15-5)14(4,8-3)16-12-7-2/h9-10,12-13,15H,6-8,11H2,1-5H3/b10-9-,16-12+/t13-,14?/m1/s1 |
| InChIKey | JLDBNEGNWZVYDF-AATONWFOSA-N |
| XLogP | 3.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine?
The IUPAC name of (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine (CID 155308601) is (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine.
What is the SMILES notation for (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine?
The canonical SMILES for (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine is CC/C=C\C[C@@H](NC)C(C)(CC)/N=C/CC.
What is the InChIKey of (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine?
The InChIKey is JLDBNEGNWZVYDF-AATONWFOSA-N. The full InChI is InChI=1S/C14H28N2/c1-6-9-10-11-13(15-5)14(4,8-3)16-12-7-2/h9-10,12-13,15H,6-8,11H2,1-5H3/b10-9-,16-12+/t13-,14?/m1/s1.
What are the key properties of (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine?
(Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine has a molecular weight of 224.39 g/mol, XLogP of 3.58, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4R)-N,3-dimethyl-3-(propylideneamino)non-6-en-4-amine is sourced from PubChem (CID 155308601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).