C27H30N6O2 — CID 155308743
N-[4-[4-amino-7-methyl-5-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide (PubChem CID 155308743) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N-[4-[4-amino-7-methyl-5-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[4-amino-7-methyl-5-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155308743 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-[4-[4-amino-7-methyl-5-[4-(pyrrolidine-1-carbonyl)cyclohexen-1-yl]pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2c(C3=CCC(C(=O)N4CCCC4)CC3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C27H30N6O2/c1-3-21(34)31-20-12-10-18(11-13-20)24-22(23-25(28)29-16-30-26(23)32(24)2)17-6-8-19(9-7-17)27(35)33-14-4-5-15-33/h3,6,10-13,16,19H,1,4-5,7-9,14-15H2,2H3,(H,31,34)(H2,28,29,30) |
| InChIKey | JMLHWAZRACQOAC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|