C27H28N6O3 — CID 155308748
4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(3-hydroxypropyl)benzamide (PubChem CID 155308748) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(3-hydroxypropyl)benzamide.
| Compound Name | 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 155308748 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(3-hydroxypropyl)benzamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2c(-c3ccc(C(=O)NCCCO)cc3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C27H28N6O3/c1-16(2)26(35)32-20-11-9-18(10-12-20)23-21(22-24(28)30-15-31-25(22)33(23)3)17-5-7-19(8-6-17)27(36)29-13-4-14-34/h5-12,15,34H,1,4,13-14H2,2-3H3,(H,29,36)(H,32,35)(H2,28,30,31) |
| InChIKey | VBSLDJGPXXNQCW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|