C26H26N6O3 — CID 155308956
4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(2-hydroxyethyl)benzamide (PubChem CID 155308956) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 155308956 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-[4-amino-7-methyl-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-N-(2-hydroxyethyl)benzamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2c(-c3ccc(C(=O)NCCO)cc3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C26H26N6O3/c1-15(2)25(34)31-19-10-8-17(9-11-19)22-20(21-23(27)29-14-30-24(21)32(22)3)16-4-6-18(7-5-16)26(35)28-12-13-33/h4-11,14,33H,1,12-13H2,2-3H3,(H,28,35)(H,31,34)(H2,27,29,30) |
| InChIKey | HDSMHAHDLUORTH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|