C27H28N6O3S — CID 155309321
N-[4-[4-amino-5-[4-(cyclobutylsulfamoyl)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide (PubChem CID 155309321) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is N-[4-[4-amino-5-[4-(cyclobutylsulfamoyl)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-amino-5-[4-(cyclobutylsulfamoyl)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 155309321 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[4-[4-amino-5-[4-(cyclobutylsulfamoyl)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2c(-c3ccc(S(=O)(=O)NC4CCC4)cc3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C27H28N6O3S/c1-16(2)27(34)31-19-11-7-18(8-12-19)24-22(23-25(28)29-15-30-26(23)33(24)3)17-9-13-21(14-10-17)37(35,36)32-20-5-4-6-20/h7-15,20,32H,1,4-6H2,2-3H3,(H,31,34)(H2,28,29,30) |
| InChIKey | KUOVECKQNWVEMD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|