C28H29N5O3S — CID 155309622
N-[4-[4-amino-5-(4-cyclopentylsulfonylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide (PubChem CID 155309622) has the molecular formula C28H29N5O3S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[4-[4-amino-5-(4-cyclopentylsulfonylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-amino-5-(4-cyclopentylsulfonylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 155309622 |
| Molecular Formula | C28H29N5O3S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | N-[4-[4-amino-5-(4-cyclopentylsulfonylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2c(-c3ccc(S(=O)(=O)C4CCCC4)cc3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C28H29N5O3S/c1-17(2)28(34)32-20-12-8-19(9-13-20)25-23(24-26(29)30-16-31-27(24)33(25)3)18-10-14-22(15-11-18)37(35,36)21-6-4-5-7-21/h8-16,21H,1,4-7H2,2-3H3,(H,32,34)(H2,29,30,31) |
| InChIKey | MZQJOEXBMBPCNI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|