About 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine
4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine (PubChem CID 155309702) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine |
| PubChem CID | 155309702 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine |
| SMILES | CON(C)c1ncnc(N)c1C |
| InChI | InChI=1S/C7H12N4O/c1-5-6(8)9-4-10-7(5)11(2)12-3/h4H,1-3H3,(H2,8,9,10) |
| InChIKey | LHTPTQLGDFLPAQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine?
The IUPAC name of 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine (CID 155309702) is 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine.
What is the SMILES notation for 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine?
The canonical SMILES for 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine is CON(C)c1ncnc(N)c1C.
What is the InChIKey of 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine?
The InChIKey is LHTPTQLGDFLPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-5-6(8)9-4-10-7(5)11(2)12-3/h4H,1-3H3,(H2,8,9,10).
What are the key properties of 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine?
4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine has a molecular weight of 168.20 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methoxy-4-N,5-dimethylpyrimidine-4,6-diamine is sourced from PubChem (CID 155309702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).