About 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol
1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol (PubChem CID 15531045) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol.
Molecular Properties
| Compound Name | 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol |
| PubChem CID | 15531045 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(c1ccccc1O)OCC2 |
| InChI | InChI=1S/C15H14O4/c16-12-4-2-1-3-10(12)15-11-8-14(18)13(17)7-9(11)5-6-19-15/h1-4,7-8,15-18H,5-6H2 |
| InChIKey | KRSZVPRPDCIJGP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol?
The IUPAC name of 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol (CID 15531045) is 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol.
What is the SMILES notation for 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol?
The canonical SMILES for 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol is Oc1cc2c(cc1O)C(c1ccccc1O)OCC2.
What is the InChIKey of 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol?
The InChIKey is KRSZVPRPDCIJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c16-12-4-2-1-3-10(12)15-11-8-14(18)13(17)7-9(11)5-6-19-15/h1-4,7-8,15-18H,5-6H2.
What are the key properties of 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol?
1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol has a molecular weight of 258.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyphenyl)-3,4-dihydro-1H-isochromene-6,7-diol is sourced from PubChem (CID 15531045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).