About dithiirane-3,3-dithiol
dithiirane-3,3-dithiol (PubChem CID 15531076) has the molecular formula CH2S4
and a molecular weight of 142.29 g/mol. Its IUPAC name is dithiirane-3,3-dithiol.
Molecular Properties
| Compound Name | dithiirane-3,3-dithiol |
| PubChem CID | 15531076 |
| Molecular Formula | CH2S4 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 141.90 |
| IUPAC Name | dithiirane-3,3-dithiol |
| SMILES | SC1(S)SS1 |
| InChI | InChI=1S/CH2S4/c2-1(3)4-5-1/h2-3H |
| InChIKey | QQWTUTNWNDLQID-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dithiirane-3,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiirane-3,3-dithiol?
The IUPAC name of dithiirane-3,3-dithiol (CID 15531076) is dithiirane-3,3-dithiol.
What is the SMILES notation for dithiirane-3,3-dithiol?
The canonical SMILES for dithiirane-3,3-dithiol is SC1(S)SS1.
What is the InChIKey of dithiirane-3,3-dithiol?
The InChIKey is QQWTUTNWNDLQID-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2S4/c2-1(3)4-5-1/h2-3H.
What are the key properties of dithiirane-3,3-dithiol?
dithiirane-3,3-dithiol has a molecular weight of 142.29 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dithiirane-3,3-dithiol is sourced from PubChem (CID 15531076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).