C24H26N6O2 — CID 155310895
5-[4-[4-amino-7-methyl-6-(1-prop-2-enoylpyrrolidin-3-yl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]pyrrolidin-2-one (PubChem CID 155310895) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[4-[4-amino-7-methyl-6-(1-prop-2-enoylpyrrolidin-3-yl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[4-amino-7-methyl-6-(1-prop-2-enoylpyrrolidin-3-yl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155310895 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 5-[4-[4-amino-7-methyl-6-(1-prop-2-enoylpyrrolidin-3-yl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]pyrrolidin-2-one |
| SMILES | C=CC(=O)N1CCC(c2c(-c3ccc(C4CCC(=O)N4)cc3)c3c(N)ncnc3n2C)C1 |
| InChI | InChI=1S/C24H26N6O2/c1-3-19(32)30-11-10-16(12-30)22-20(21-23(25)26-13-27-24(21)29(22)2)15-6-4-14(5-7-15)17-8-9-18(31)28-17/h3-7,13,16-17H,1,8-12H2,2H3,(H,28,31)(H2,25,26,27) |
| InChIKey | QGPGWSNKWDMETK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|