C19H19N5O3S2 — CID 155311084
N-[4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-2-morpholin-4-ylthieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 155311084) has the molecular formula C19H19N5O3S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is N-[4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-2-morpholin-4-ylthieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-[4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-2-morpholin-4-ylthieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155311084 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-2-morpholin-4-ylthieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | CC1=NNC(c2ccc(NC(=O)c3cc4sc(N5CCOCC5)nc4s3)cc2)O1 |
| InChI | InChI=1S/C19H19N5O3S2/c1-11-22-23-17(27-11)12-2-4-13(5-3-12)20-16(25)14-10-15-18(28-14)21-19(29-15)24-6-8-26-9-7-24/h2-5,10,17,23H,6-9H2,1H3,(H,20,25) |
| InChIKey | HPKHABNTPKCMIG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |