C10H17N — CID 155311440
2,3,4,6-tetramethylcyclohexa-2,4-dien-1-amine (PubChem CID 155311440) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,3,4,6-tetramethylcyclohexa-2,4-dien-1-amine.
| Compound Name | 2,3,4,6-tetramethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 155311440 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,3,4,6-tetramethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CC(C)C(N)C(C)=C1C |
| InChI | InChI=1S/C10H17N/c1-6-5-7(2)10(11)9(4)8(6)3/h5,7,10H,11H2,1-4H3 |
| InChIKey | PHLBPMZURAJMIP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |