C24H24FN5O6 — CID 155311803
tert-butyl 21-fluoro-10-[(2Z)-2-hydroxyiminopropanoyl]-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene-3-carboxylate (PubChem CID 155311803) has the molecular formula C24H24FN5O6 and a molecular weight of 497.48 g/mol. Its IUPAC name is tert-butyl 21-fluoro-10-[(2Z)-2-hydroxyiminopropanoyl]-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene-3-carboxylate.
| Compound Name | tert-butyl 21-fluoro-10-[(2Z)-2-hydroxyiminopropanoyl]-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene-3-carboxylate |
|---|---|
| PubChem CID | 155311803 |
| Molecular Formula | C24H24FN5O6 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | tert-butyl 21-fluoro-10-[(2Z)-2-hydroxyiminopropanoyl]-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene-3-carboxylate |
| SMILES | C/C(=N/O)C(=O)c1cc2c(n3cnnc13)N(C(=O)OC(C)(C)C)Cc1c(F)ccc3c1C(CO3)CO2 |
| InChI | InChI=1S/C24H24FN5O6/c1-12(28-33)20(31)14-7-18-22(30-11-26-27-21(14)30)29(23(32)36-24(2,3)4)8-15-16(25)5-6-17-19(15)13(9-34-17)10-35-18/h5-7,11,13,33H,8-10H2,1-4H3/b28-12- |
| InChIKey | UUAQJDBGSVAXMP-NVJOKUIPSA-N |
| XLogP | 3.71 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|