C18H28N2 — CID 155312182
(2Z,4Z)-4-ethylidene-6,7-dimethyl-N'-[(2Z)-penta-2,4-dien-2-yl]nona-2,8-dienimidamide (PubChem CID 155312182) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (2Z,4Z)-4-ethylidene-6,7-dimethyl-N'-[(2Z)-penta-2,4-dien-2-yl]nona-2,8-dienimidamide.
| Compound Name | (2Z,4Z)-4-ethylidene-6,7-dimethyl-N'-[(2Z)-penta-2,4-dien-2-yl]nona-2,8-dienimidamide |
|---|---|
| PubChem CID | 155312182 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (2Z,4Z)-4-ethylidene-6,7-dimethyl-N'-[(2Z)-penta-2,4-dien-2-yl]nona-2,8-dienimidamide |
| SMILES | C=C/C=C(C)\N=C(N)\C=C/C(=C\C)CC(C)C(C)C=C |
| InChI | InChI=1S/C18H28N2/c1-7-10-16(6)20-18(19)12-11-17(9-3)13-15(5)14(4)8-2/h7-12,14-15H,1-2,13H2,3-6H3,(H2,19,20)/b12-11-,16-10-,17-9+ |
| InChIKey | NBKJPARJYCUGSQ-SLGBQARUSA-N |
| XLogP | 4.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|