About 2-chloro-3,4,5,6-tetrafluoroaniline
2-chloro-3,4,5,6-tetrafluoroaniline (PubChem CID 15531220) has the molecular formula C6H2ClF4N
and a molecular weight of 199.53 g/mol. Its IUPAC name is 2-chloro-3,4,5,6-tetrafluoroaniline.
Molecular Properties
| Compound Name | 2-chloro-3,4,5,6-tetrafluoroaniline |
| PubChem CID | 15531220 |
| Molecular Formula | C6H2ClF4N |
| Molecular Weight | 199.53 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 2-chloro-3,4,5,6-tetrafluoroaniline |
| SMILES | Nc1c(F)c(F)c(F)c(F)c1Cl |
| InChI | InChI=1S/C6H2ClF4N/c7-1-2(8)3(9)4(10)5(11)6(1)12/h12H2 |
| InChIKey | DCEVXDRTLUQJSC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,4,5,6-tetrafluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,4,5,6-tetrafluoroaniline?
The IUPAC name of 2-chloro-3,4,5,6-tetrafluoroaniline (CID 15531220) is 2-chloro-3,4,5,6-tetrafluoroaniline.
What is the SMILES notation for 2-chloro-3,4,5,6-tetrafluoroaniline?
The canonical SMILES for 2-chloro-3,4,5,6-tetrafluoroaniline is Nc1c(F)c(F)c(F)c(F)c1Cl.
What is the InChIKey of 2-chloro-3,4,5,6-tetrafluoroaniline?
The InChIKey is DCEVXDRTLUQJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF4N/c7-1-2(8)3(9)4(10)5(11)6(1)12/h12H2.
What are the key properties of 2-chloro-3,4,5,6-tetrafluoroaniline?
2-chloro-3,4,5,6-tetrafluoroaniline has a molecular weight of 199.53 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,4,5,6-tetrafluoroaniline is sourced from PubChem (CID 15531220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).