About 7-ethyl-7-methylpyrido[3,2-b]azepine
7-ethyl-7-methylpyrido[3,2-b]azepine (PubChem CID 155312347) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 7-ethyl-7-methylpyrido[3,2-b]azepine.
Molecular Properties
| Compound Name | 7-ethyl-7-methylpyrido[3,2-b]azepine |
| PubChem CID | 155312347 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 7-ethyl-7-methylpyrido[3,2-b]azepine |
| SMILES | CCC1(C)C=Cc2ncccc2N=C1 |
| InChI | InChI=1S/C12H14N2/c1-3-12(2)7-6-11-10(14-9-12)5-4-8-13-11/h4-9H,3H2,1-2H3 |
| InChIKey | UOGYFNBIGKCNNG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-7-methylpyrido[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-7-methylpyrido[3,2-b]azepine?
The IUPAC name of 7-ethyl-7-methylpyrido[3,2-b]azepine (CID 155312347) is 7-ethyl-7-methylpyrido[3,2-b]azepine.
What is the SMILES notation for 7-ethyl-7-methylpyrido[3,2-b]azepine?
The canonical SMILES for 7-ethyl-7-methylpyrido[3,2-b]azepine is CCC1(C)C=Cc2ncccc2N=C1.
What is the InChIKey of 7-ethyl-7-methylpyrido[3,2-b]azepine?
The InChIKey is UOGYFNBIGKCNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-12(2)7-6-11-10(14-9-12)5-4-8-13-11/h4-9H,3H2,1-2H3.
What are the key properties of 7-ethyl-7-methylpyrido[3,2-b]azepine?
7-ethyl-7-methylpyrido[3,2-b]azepine has a molecular weight of 186.26 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-7-methylpyrido[3,2-b]azepine is sourced from PubChem (CID 155312347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).