About (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol
(3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol (PubChem CID 155312433) has the molecular formula C9H11ClF3N3O
and a molecular weight of 269.65 g/mol. Its IUPAC name is (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol |
| PubChem CID | 155312433 |
| Molecular Formula | C9H11ClF3N3O |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol |
| SMILES | OCC[C@H](CC(F)(F)F)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H11ClF3N3O/c10-7-1-2-8(16-15-7)14-6(3-4-17)5-9(11,12)13/h1-2,6,17H,3-5H2,(H,14,16)/t6-/m1/s1 |
| InChIKey | WNIMRXOUPZBXHU-ZCFIWIBFSA-N |
| XLogP | 2.25 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol?
The IUPAC name of (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol (CID 155312433) is (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol.
What is the SMILES notation for (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol?
The canonical SMILES for (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol is OCC[C@H](CC(F)(F)F)Nc1ccc(Cl)nn1.
What is the InChIKey of (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol?
The InChIKey is WNIMRXOUPZBXHU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H11ClF3N3O/c10-7-1-2-8(16-15-7)14-6(3-4-17)5-9(11,12)13/h1-2,6,17H,3-5H2,(H,14,16)/t6-/m1/s1.
What are the key properties of (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol?
(3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol has a molecular weight of 269.65 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(6-chloropyridazin-3-yl)amino]-5,5,5-trifluoropentan-1-ol is sourced from PubChem (CID 155312433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).