About 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea
1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea (PubChem CID 155313188) has the molecular formula C27H22N2O5P2
and a molecular weight of 516.43 g/mol. Its IUPAC name is 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea.
Molecular Properties
| Compound Name | 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea |
| PubChem CID | 155313188 |
| Molecular Formula | C27H22N2O5P2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea |
| SMILES | O=C(NCP1(=O)Oc2ccccc2-c2ccccc21)NCP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22N2O5P2/c30-27(28-17-35(31)25-15-7-3-11-21(25)19-9-1-5-13-23(19)33-35)29-18-36(32)26-16-8-4-12-22(26)20-10-2-6-14-24(20)34-36/h1-16H,17-18H2,(H2,28,29,30) |
| InChIKey | RQTCSGWJMUGOJM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea?
The IUPAC name of 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea (CID 155313188) is 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea.
What is the SMILES notation for 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea?
The canonical SMILES for 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea is O=C(NCP1(=O)Oc2ccccc2-c2ccccc21)NCP1(=O)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea?
The InChIKey is RQTCSGWJMUGOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N2O5P2/c30-27(28-17-35(31)25-15-7-3-11-21(25)19-9-1-5-13-23(19)33-35)29-18-36(32)26-16-8-4-12-22(26)20-10-2-6-14-24(20)34-36/h1-16H,17-18H2,(H2,28,29,30).
What are the key properties of 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea?
1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea has a molecular weight of 516.43 g/mol, XLogP of 5.53, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]urea is sourced from PubChem (CID 155313188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).