C17H20ClN3OS — CID 155313394
N-(4-chlorophenyl)sulfanyl-2-methoxy-7-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-amine (PubChem CID 155313394) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfanyl-2-methoxy-7-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-amine.
| Compound Name | N-(4-chlorophenyl)sulfanyl-2-methoxy-7-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-amine |
|---|---|
| PubChem CID | 155313394 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(4-chlorophenyl)sulfanyl-2-methoxy-7-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-amine |
| SMILES | COc1nc2c(cc1NSc1ccc(Cl)cc1)CCN(C)CC2 |
| InChI | InChI=1S/C17H20ClN3OS/c1-21-9-7-12-11-16(17(22-2)19-15(12)8-10-21)20-23-14-5-3-13(18)4-6-14/h3-6,11,20H,7-10H2,1-2H3 |
| InChIKey | IZYDOECUKXAWGW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|