C22H20N2O4 — CID 155313818
(2E,3E)-3-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2-prop-2-enylidenehexa-3,5-dienoic acid (PubChem CID 155313818) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2E,3E)-3-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2-prop-2-enylidenehexa-3,5-dienoic acid.
| Compound Name | (2E,3E)-3-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2-prop-2-enylidenehexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 155313818 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2E,3E)-3-[[4-(4-aminophenoxy)phenyl]carbamoyl]-2-prop-2-enylidenehexa-3,5-dienoic acid |
| SMILES | C=C/C=C(C(=O)O)\C(=C/C=C)C(=O)Nc1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-3-5-19(20(6-4-2)22(26)27)21(25)24-16-9-13-18(14-10-16)28-17-11-7-15(23)8-12-17/h3-14H,1-2,23H2,(H,24,25)(H,26,27)/b19-5+,20-6+ |
| InChIKey | LRDHWAGZKNILFW-OGBZJDJUSA-N |
| XLogP | 4.31 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|