About methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate
methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate (PubChem CID 155313850) has the molecular formula C25H36O2S
and a molecular weight of 400.63 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate |
| PubChem CID | 155313850 |
| Molecular Formula | C25H36O2S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1CCC[C@@H]1CCCc1cc2c(s1)C=CCC=C2 |
| InChI | InChI=1S/C25H36O2S/c1-27-25(26)18-8-3-2-5-11-20-13-9-14-21(20)15-10-16-23-19-22-12-6-4-7-17-24(22)28-23/h6-7,12,17,19-21H,2-5,8-11,13-16,18H2,1H3/t20-,21+/m0/s1 |
| InChIKey | PUQHTRRCOGOCSI-LEWJYISDSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate (CID 155313850) is methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate is COC(=O)CCCCCC[C@H]1CCC[C@@H]1CCCc1cc2c(s1)C=CCC=C2.
What is the InChIKey of methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate?
The InChIKey is PUQHTRRCOGOCSI-LEWJYISDSA-N. The full InChI is InChI=1S/C25H36O2S/c1-27-25(26)18-8-3-2-5-11-20-13-9-14-21(20)15-10-16-23-19-22-12-6-4-7-17-24(22)28-23/h6-7,12,17,19-21H,2-5,8-11,13-16,18H2,1H3/t20-,21+/m0/s1.
What are the key properties of methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate?
methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate has a molecular weight of 400.63 g/mol, XLogP of 7.43, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1S,2R)-2-[3-(6H-cyclohepta[b]thiophen-2-yl)propyl]cyclopentyl]heptanoate is sourced from PubChem (CID 155313850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).