C24H27N3O3 — CID 155313897
[3-[[(4R)-7-(N,4-dimethylanilino)-3,4-dihydro-2H-chromen-4-yl]methylamino]-4-pyridinyl]methanediol (PubChem CID 155313897) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [3-[[(4R)-7-(N,4-dimethylanilino)-3,4-dihydro-2H-chromen-4-yl]methylamino]-4-pyridinyl]methanediol.
| Compound Name | [3-[[(4R)-7-(N,4-dimethylanilino)-3,4-dihydro-2H-chromen-4-yl]methylamino]-4-pyridinyl]methanediol |
|---|---|
| PubChem CID | 155313897 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [3-[[(4R)-7-(N,4-dimethylanilino)-3,4-dihydro-2H-chromen-4-yl]methylamino]-4-pyridinyl]methanediol |
| SMILES | Cc1ccc(N(C)c2ccc3c(c2)OCC[C@H]3CNc2cnccc2C(O)O)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-16-3-5-18(6-4-16)27(2)19-7-8-20-17(10-12-30-23(20)13-19)14-26-22-15-25-11-9-21(22)24(28)29/h3-9,11,13,15,17,24,26,28-29H,10,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | RCEWIOSFWHEORH-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|