C20H26N2O3 — CID 155313925
[3-[(6-propoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylamino]-4-pyridinyl]methanediol (PubChem CID 155313925) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is [3-[(6-propoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylamino]-4-pyridinyl]methanediol.
| Compound Name | [3-[(6-propoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylamino]-4-pyridinyl]methanediol |
|---|---|
| PubChem CID | 155313925 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [3-[(6-propoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylamino]-4-pyridinyl]methanediol |
| SMILES | CCCOc1ccc2c(c1)CCCC2CNc1cnccc1C(O)O |
| InChI | InChI=1S/C20H26N2O3/c1-2-10-25-16-6-7-17-14(11-16)4-3-5-15(17)12-22-19-13-21-9-8-18(19)20(23)24/h6-9,11,13,15,20,22-24H,2-5,10,12H2,1H3 |
| InChIKey | DXOXDPUYUUMJJG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|