About [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine
[(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine (PubChem CID 155314029) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine |
| PubChem CID | 155314029 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine |
| SMILES | COC(/C=C(\C)OC)=C1/CCCCC1CN |
| InChI | InChI=1S/C13H23NO2/c1-10(15-2)8-13(16-3)12-7-5-4-6-11(12)9-14/h8,11H,4-7,9,14H2,1-3H3/b10-8+,13-12- |
| InChIKey | JQSDFOCZDMURQD-SMEYHRCOSA-N |
| XLogP | 2.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine?
The IUPAC name of [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine (CID 155314029) is [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine.
What is the SMILES notation for [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine?
The canonical SMILES for [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine is COC(/C=C(\C)OC)=C1/CCCCC1CN.
What is the InChIKey of [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine?
The InChIKey is JQSDFOCZDMURQD-SMEYHRCOSA-N. The full InChI is InChI=1S/C13H23NO2/c1-10(15-2)8-13(16-3)12-7-5-4-6-11(12)9-14/h8,11H,4-7,9,14H2,1-3H3/b10-8+,13-12-.
What are the key properties of [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine?
[(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine has a molecular weight of 225.33 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-[(E)-1,3-dimethoxybut-2-enylidene]cyclohexyl]methanamine is sourced from PubChem (CID 155314029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).