C15H21NO3 — CID 155314047
(5R,6R)-6-(cyclopentylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol (PubChem CID 155314047) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (5R,6R)-6-(cyclopentylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol.
| Compound Name | (5R,6R)-6-(cyclopentylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 155314047 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (5R,6R)-6-(cyclopentylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
| SMILES | Oc1ccc2c(c1O)CC[C@@H](NC1CCCC1)[C@@H]2O |
| InChI | InChI=1S/C15H21NO3/c17-13-8-6-10-11(15(13)19)5-7-12(14(10)18)16-9-3-1-2-4-9/h6,8-9,12,14,16-19H,1-5,7H2/t12-,14-/m1/s1 |
| InChIKey | CALZDBOFBGCWQC-TZMCWYRMSA-N |
| XLogP | 1.98 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|