About 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane
4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane (PubChem CID 15531435) has the molecular formula C14H16OSi
and a molecular weight of 228.37 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane |
| PubChem CID | 15531435 |
| Molecular Formula | C14H16OSi |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane |
| SMILES | COc1ccccc1C#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H16OSi/c1-15-14-11-6-5-9-13(14)10-7-8-12-16(2,3)4/h5-6,9,11H,1-4H3 |
| InChIKey | XCVOGISTYCBYMH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane?
The IUPAC name of 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane (CID 15531435) is 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane.
What is the SMILES notation for 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane?
The canonical SMILES for 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane is COc1ccccc1C#CC#C[Si](C)(C)C.
What is the InChIKey of 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane?
The InChIKey is XCVOGISTYCBYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16OSi/c1-15-14-11-6-5-9-13(14)10-7-8-12-16(2,3)4/h5-6,9,11H,1-4H3.
What are the key properties of 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane?
4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane has a molecular weight of 228.37 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)buta-1,3-diynyl-trimethylsilane is sourced from PubChem (CID 15531435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).