About lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole
lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 15531439) has the molecular formula C6H9ClLiNO
and a molecular weight of 153.54 g/mol. Its IUPAC name is lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 15531439 |
| Molecular Formula | C6H9ClLiNO |
| Molecular Weight | 153.54 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([CH-]Cl)=N1.[Li+] |
| InChI | InChI=1S/C6H9ClNO.Li/c1-6(2)4-9-5(3-7)8-6;/h3H,4H2,1-2H3;/q-1;+1 |
| InChIKey | NSGJMARCPCJLGD-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.54 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole (CID 15531439) is lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole is CC1(C)COC([CH-]Cl)=N1.[Li+].
What is the InChIKey of lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is NSGJMARCPCJLGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClNO.Li/c1-6(2)4-9-5(3-7)8-6;/h3H,4H2,1-2H3;/q-1;+1.
What are the key properties of lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole?
lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 153.54 g/mol, XLogP of -1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-(chloromethyl)-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 15531439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).