C26H14Cl3FN8 — CID 155314742
6-chloro-8-[[(S)-(3-cyanophenyl)-(2H-triazol-4-yl)methyl]amino]-4-(3,4-dichloro-2-fluoroanilino)quinoline-3-carbonitrile (PubChem CID 155314742) has the molecular formula C26H14Cl3FN8 and a molecular weight of 563.81 g/mol. Its IUPAC name is 6-chloro-8-[[(S)-(3-cyanophenyl)-(2H-triazol-4-yl)methyl]amino]-4-(3,4-dichloro-2-fluoroanilino)quinoline-3-carbonitrile.
| Compound Name | 6-chloro-8-[[(S)-(3-cyanophenyl)-(2H-triazol-4-yl)methyl]amino]-4-(3,4-dichloro-2-fluoroanilino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 155314742 |
| Molecular Formula | C26H14Cl3FN8 |
| Molecular Weight | 563.81 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 6-chloro-8-[[(S)-(3-cyanophenyl)-(2H-triazol-4-yl)methyl]amino]-4-(3,4-dichloro-2-fluoroanilino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cccc([C@H](Nc2cc(Cl)cc3c(Nc4ccc(Cl)c(Cl)c4F)c(C#N)cnc23)c2cn[nH]n2)c1 |
| InChI | InChI=1S/C26H14Cl3FN8/c27-16-7-17-24(35-19-5-4-18(28)22(29)23(19)30)15(10-32)11-33-26(17)20(8-16)36-25(21-12-34-38-37-21)14-3-1-2-13(6-14)9-31/h1-8,11-12,25,36H,(H,33,35)(H,34,37,38)/t25-/m0/s1 |
| InChIKey | QCWGJXXRKCVGDB-VWLOTQADSA-N |
| XLogP | 7.14 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.81 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|