C35H41N7O5S — CID 155314986
1-[3-tert-butyl-5-(methylsulfamoyl)phenyl]-3-[(1S,4R)-4-[[3-[(2S)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1-formyl-4H-naphthalen-1-yl]urea (PubChem CID 155314986) has the molecular formula C35H41N7O5S and a molecular weight of 671.82 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-(methylsulfamoyl)phenyl]-3-[(1S,4R)-4-[[3-[(2S)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1-formyl-4H-naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-5-(methylsulfamoyl)phenyl]-3-[(1S,4R)-4-[[3-[(2S)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1-formyl-4H-naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 155314986 |
| Molecular Formula | C35H41N7O5S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | 1-[3-tert-butyl-5-(methylsulfamoyl)phenyl]-3-[(1S,4R)-4-[[3-[(2S)-1,2-dimethylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-1-formyl-4H-naphthalen-1-yl]urea |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)N[C@@]2(C=O)C=C[C@@H](Oc3ccc4nnc([C@]5(C)CCCN5C)n4c3)c3ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H41N7O5S/c1-33(2,3)23-18-24(20-26(19-23)48(45,46)36-5)37-32(44)38-35(22-43)16-14-29(27-10-7-8-11-28(27)35)47-25-12-13-30-39-40-31(42(30)21-25)34(4)15-9-17-41(34)6/h7-8,10-14,16,18-22,29,36H,9,15,17H2,1-6H3,(H2,37,38,44)/t29-,34+,35-/m1/s1 |
| InChIKey | FWFTUNOQWCTMDU-FSWPNNSKSA-N |
| XLogP | 4.78 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|