C14H13FN4O4 — CID 155315493
(2S,4S)-4-[4-(3-fluorophenyl)triazol-1-yl]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 155315493) has the molecular formula C14H13FN4O4 and a molecular weight of 320.28 g/mol. Its IUPAC name is (2S,4S)-4-[4-(3-fluorophenyl)triazol-1-yl]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4S)-4-[4-(3-fluorophenyl)triazol-1-yl]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 155315493 |
| Molecular Formula | C14H13FN4O4 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (2S,4S)-4-[4-(3-fluorophenyl)triazol-1-yl]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](n2cc(-c3cccc(F)c3)nn2)CN1C(=O)O |
| InChI | InChI=1S/C14H13FN4O4/c15-9-3-1-2-8(4-9)11-7-19(17-16-11)10-5-12(13(20)21)18(6-10)14(22)23/h1-4,7,10,12H,5-6H2,(H,20,21)(H,22,23)/t10-,12-/m0/s1 |
| InChIKey | MCOMSSZQELRSDN-JQWIXIFHSA-N |
| XLogP | 1.46 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |