C22H36N2 — CID 155315991
(2Z,4E,6E,8Z)-6-butan-2-yl-2,4,5-trimethyl-9-N-methylidenetetradeca-2,4,6,8-tetraene-1,9-diimine (PubChem CID 155315991) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is (2Z,4E,6E,8Z)-6-butan-2-yl-2,4,5-trimethyl-9-N-methylidenetetradeca-2,4,6,8-tetraene-1,9-diimine.
| Compound Name | (2Z,4E,6E,8Z)-6-butan-2-yl-2,4,5-trimethyl-9-N-methylidenetetradeca-2,4,6,8-tetraene-1,9-diimine |
|---|---|
| PubChem CID | 155315991 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | (2Z,4E,6E,8Z)-6-butan-2-yl-2,4,5-trimethyl-9-N-methylidenetetradeca-2,4,6,8-tetraene-1,9-diimine |
| SMILES | [H]/N=C/C(C)=C\C(C)=C(C)\C(=C\C=C(\CCCCC)N=C)C(C)CC |
| InChI | InChI=1S/C22H36N2/c1-8-10-11-12-21(24-7)13-14-22(18(4)9-2)20(6)19(5)15-17(3)16-23/h13-16,18,23H,7-12H2,1-6H3/b17-15-,20-19+,21-13-,22-14+,23-16+ |
| InChIKey | NDGNPYHNROALSS-PSXJHTSKSA-N |
| XLogP | 7.06 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|