C24H32FN7O — CID 155316061
5-(5-fluoro-3,4-dihydro-2H-azepin-6-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]pyridin-3-ol (PubChem CID 155316061) has the molecular formula C24H32FN7O and a molecular weight of 453.57 g/mol. Its IUPAC name is 5-(5-fluoro-3,4-dihydro-2H-azepin-6-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]pyridin-3-ol.
| Compound Name | 5-(5-fluoro-3,4-dihydro-2H-azepin-6-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 155316061 |
| Molecular Formula | C24H32FN7O |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 5-(5-fluoro-3,4-dihydro-2H-azepin-6-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]pyridin-3-ol |
| SMILES | CN(c1ncc(-c2ncc(C3=C(F)CCCN=C3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H32FN7O/c1-23(2)10-16(11-24(3,4)31-23)32(5)22-28-14-19(29-30-22)21-20(33)9-15(12-27-21)17-13-26-8-6-7-18(17)25/h9,12-14,16,31,33H,6-8,10-11H2,1-5H3 |
| InChIKey | SVLJIYOKMYNETH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |