About chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide
chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide (PubChem CID 15531636) has the molecular formula C9H13ClO3Zn
and a molecular weight of 270.04 g/mol. Its IUPAC name is chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide.
Molecular Properties
| Compound Name | chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide |
| PubChem CID | 15531636 |
| Molecular Formula | C9H13ClO3Zn |
| Molecular Weight | 270.04 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide |
| SMILES | CCOC(OCC)c1cc[c-]o1.Cl[Zn+] |
| InChI | InChI=1S/C9H13O3.ClH.Zn/c1-3-10-9(11-4-2)8-6-5-7-12-8;;/h5-6,9H,3-4H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | YOGOXTLXIFRXAK-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.04 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide?
The IUPAC name of chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide (CID 15531636) is chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide.
What is the SMILES notation for chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide?
The canonical SMILES for chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide is CCOC(OCC)c1cc[c-]o1.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide?
The InChIKey is YOGOXTLXIFRXAK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13O3.ClH.Zn/c1-3-10-9(11-4-2)8-6-5-7-12-8;;/h5-6,9H,3-4H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide?
chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide has a molecular weight of 270.04 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);5-(diethoxymethyl)-2H-furan-2-ide is sourced from PubChem (CID 15531636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).