C51H53N2+ — CID 155316522
4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazol-1-ium (PubChem CID 155316522) has the molecular formula C51H53N2+ and a molecular weight of 694.00 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazol-1-ium.
| Compound Name | 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazol-1-ium |
|---|---|
| PubChem CID | 155316522 |
| Molecular Formula | C51H53N2+ |
| Molecular Weight | 694.00 g/mol |
| Exact Mass | 693.42 |
| IUPAC Name | 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazol-1-ium |
| SMILES | Cc1cc([C@H](C)c2ccccc2)c(-n2c[n+](-c3c([C@H](C)c4ccccc4)cc(C)cc3[C@H](C)c3ccccc3)c(C)c2C)c([C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C51H53N2/c1-34-29-46(36(3)42-21-13-9-14-22-42)50(47(30-34)37(4)43-23-15-10-16-24-43)52-33-53(41(8)40(52)7)51-48(38(5)44-25-17-11-18-26-44)31-35(2)32-49(51)39(6)45-27-19-12-20-28-45/h9-33,36-39H,1-8H3/q+1/t36-,37-,38-,39-/m1/s1 |
| InChIKey | BRZSPILXHCEHCC-WRCAVZGJSA-N |
| XLogP | 12.59 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.00 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|