C42H33N7 — CID 155316648
3-N-(3,4-diphenylphenyl)-1-N-[(Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)amino]-3-N-[3-[(2Z)-2-(6-iminocyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenyl]benzene-1,3-diamine (PubChem CID 155316648) has the molecular formula C42H33N7 and a molecular weight of 635.78 g/mol. Its IUPAC name is 3-N-(3,4-diphenylphenyl)-1-N-[(Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)amino]-3-N-[3-[(2Z)-2-(6-iminocyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenyl]benzene-1,3-diamine.
| Compound Name | 3-N-(3,4-diphenylphenyl)-1-N-[(Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)amino]-3-N-[3-[(2Z)-2-(6-iminocyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 155316648 |
| Molecular Formula | C42H33N7 |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | 3-N-(3,4-diphenylphenyl)-1-N-[(Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)amino]-3-N-[3-[(2Z)-2-(6-iminocyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenyl]benzene-1,3-diamine |
| SMILES | [H]/N=C1\C=CC=C\C1=N\Nc1cccc(N(c2cccc(N/N=C3/C=CC=C/C3=N\[H])c2)c2ccc(-c3ccccc3)c(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C42H33N7/c43-39-21-7-9-23-41(39)47-45-32-17-11-19-34(27-32)49(35-20-12-18-33(28-35)46-48-42-24-10-8-22-40(42)44)36-25-26-37(30-13-3-1-4-14-30)38(29-36)31-15-5-2-6-16-31/h1-29,43-46H/b43-39+,44-40+,47-41-,48-42- |
| InChIKey | JDLCEPQZQZAVHO-GKRPRAMCSA-N |
| XLogP | 10.32 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|